C11H14Br2N2O2 — CID 110507487
2-[(2E)-2-[(3,5-dibromo-4-ethoxyphenyl)methylidene]hydrazinyl]ethanol (PubChem CID 110507487) has the molecular formula C11H14Br2N2O2 and a molecular weight of 366.05 g/mol. Its IUPAC name is 2-[(2E)-2-[(3,5-dibromo-4-ethoxyphenyl)methylidene]hydrazinyl]ethanol.
| Compound Name | 2-[(2E)-2-[(3,5-dibromo-4-ethoxyphenyl)methylidene]hydrazinyl]ethanol |
|---|---|
| PubChem CID | 110507487 |
| Molecular Formula | C11H14Br2N2O2 |
| Molecular Weight | 366.05 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | 2-[(2E)-2-[(3,5-dibromo-4-ethoxyphenyl)methylidene]hydrazinyl]ethanol |
| SMILES | CCOc1c(Br)cc(/C=N/NCCO)cc1Br |
| InChI | InChI=1S/C11H14Br2N2O2/c1-2-17-11-9(12)5-8(6-10(11)13)7-15-14-3-4-16/h5-7,14,16H,2-4H2,1H3/b15-7+ |
| InChIKey | LJHNAOBCLKQCPV-VIZOYTHASA-N |
| XLogP | 2.53 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.05 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|