C11H20OS2 — CID 11053518
methyl (2S)-2-[(1R)-1-hydroxy-2,2-dimethylpropyl]pent-4-enedithioate (PubChem CID 11053518) has the molecular formula C11H20OS2 and a molecular weight of 232.41 g/mol. Its IUPAC name is methyl (2S)-2-[(1R)-1-hydroxy-2,2-dimethylpropyl]pent-4-enedithioate.
| Compound Name | methyl (2S)-2-[(1R)-1-hydroxy-2,2-dimethylpropyl]pent-4-enedithioate |
|---|---|
| PubChem CID | 11053518 |
| Molecular Formula | C11H20OS2 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | methyl (2S)-2-[(1R)-1-hydroxy-2,2-dimethylpropyl]pent-4-enedithioate |
| SMILES | C=CC[C@H](C(=S)SC)[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C11H20OS2/c1-6-7-8(10(13)14-5)9(12)11(2,3)4/h6,8-9,12H,1,7H2,2-5H3/t8-,9+/m0/s1 |
| InChIKey | SUMLXUFZLWZQBT-DTWKUNHWSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|