C22H44O3Si2 — CID 11058731
(Z,6S)-6,10-bis[[tert-butyl(dimethyl)silyl]oxy]dec-4-en-1-yn-3-ol (PubChem CID 11058731) has the molecular formula C22H44O3Si2 and a molecular weight of 412.76 g/mol. Its IUPAC name is (Z,6S)-6,10-bis[[tert-butyl(dimethyl)silyl]oxy]dec-4-en-1-yn-3-ol.
| Compound Name | (Z,6S)-6,10-bis[[tert-butyl(dimethyl)silyl]oxy]dec-4-en-1-yn-3-ol |
|---|---|
| PubChem CID | 11058731 |
| Molecular Formula | C22H44O3Si2 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (Z,6S)-6,10-bis[[tert-butyl(dimethyl)silyl]oxy]dec-4-en-1-yn-3-ol |
| SMILES | C#CC(O)/C=C\[C@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O3Si2/c1-12-19(23)16-17-20(25-27(10,11)22(5,6)7)15-13-14-18-24-26(8,9)21(2,3)4/h1,16-17,19-20,23H,13-15,18H2,2-11H3/b17-16-/t19?,20-/m0/s1 |
| InChIKey | AFORZOULKWOEPO-RYMXYJDFSA-N |
| XLogP | 6.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|