C20H40O3Si2 — CID 123175905
(6S)-6,10-bis[[tert-butyl(methyl)silyl]oxy]dec-4-en-1-yn-3-ol (PubChem CID 123175905) has the molecular formula C20H40O3Si2 and a molecular weight of 384.71 g/mol. Its IUPAC name is (6S)-6,10-bis[[tert-butyl(methyl)silyl]oxy]dec-4-en-1-yn-3-ol.
| Compound Name | (6S)-6,10-bis[[tert-butyl(methyl)silyl]oxy]dec-4-en-1-yn-3-ol |
|---|---|
| PubChem CID | 123175905 |
| Molecular Formula | C20H40O3Si2 |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (6S)-6,10-bis[[tert-butyl(methyl)silyl]oxy]dec-4-en-1-yn-3-ol |
| SMILES | C#CC(O)C=C[C@H](CCCCO[SiH](C)C(C)(C)C)O[SiH](C)C(C)(C)C |
| InChI | InChI=1S/C20H40O3Si2/c1-10-17(21)14-15-18(23-25(9)20(5,6)7)13-11-12-16-22-24(8)19(2,3)4/h1,14-15,17-18,21,24-25H,11-13,16H2,2-9H3/t17?,18-,24?,25?/m0/s1 |
| InChIKey | QJTVOYRBAAEEBQ-URGFXZKMSA-N |
| XLogP | 4.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|