C22H46O3Si — CID 11101113
(Z,5R,8R)-12-tri(propan-2-yl)silyloxytridec-6-ene-5,8-diol (PubChem CID 11101113) has the molecular formula C22H46O3Si and a molecular weight of 386.69 g/mol. Its IUPAC name is (Z,5R,8R)-12-tri(propan-2-yl)silyloxytridec-6-ene-5,8-diol.
| Compound Name | (Z,5R,8R)-12-tri(propan-2-yl)silyloxytridec-6-ene-5,8-diol |
|---|---|
| PubChem CID | 11101113 |
| Molecular Formula | C22H46O3Si |
| Molecular Weight | 386.69 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | (Z,5R,8R)-12-tri(propan-2-yl)silyloxytridec-6-ene-5,8-diol |
| SMILES | CCCC[C@@H](O)/C=C\[C@H](O)CCCC(C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H46O3Si/c1-9-10-13-21(23)15-16-22(24)14-11-12-20(8)25-26(17(2)3,18(4)5)19(6)7/h15-24H,9-14H2,1-8H3/b16-15-/t20?,21-,22-/m1/s1 |
| InChIKey | BLURPVMTRDANNW-VEVKINEVSA-N |
| XLogP | 6.21 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.69 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|