C28H42O7SSi — CID 11060680
[(2R,3R,4R,5R)-2-benzyl-3,4-dihydroxy-5-tri(propan-2-yl)silyloxyoxolan-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11060680) has the molecular formula C28H42O7SSi and a molecular weight of 550.79 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-benzyl-3,4-dihydroxy-5-tri(propan-2-yl)silyloxyoxolan-3-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4R,5R)-2-benzyl-3,4-dihydroxy-5-tri(propan-2-yl)silyloxyoxolan-3-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11060680 |
| Molecular Formula | C28H42O7SSi |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | [(2R,3R,4R,5R)-2-benzyl-3,4-dihydroxy-5-tri(propan-2-yl)silyloxyoxolan-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@]2(O)[C@@H](Cc3ccccc3)O[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]2O)cc1 |
| InChI | InChI=1S/C28H42O7SSi/c1-19(2)37(20(3)4,21(5)6)35-27-26(29)28(30,25(34-27)17-23-11-9-8-10-12-23)18-33-36(31,32)24-15-13-22(7)14-16-24/h8-16,19-21,25-27,29-30H,17-18H2,1-7H3/t25-,26+,27-,28+/m1/s1 |
| InChIKey | ZGAVHASSDBOEOH-GCFVYEKYSA-N |
| XLogP | 4.95 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|