C22H33N5O2 — CID 11060927
8,11,14,17,20-pentazatricyclo[20.3.1.12,6]heptacosa-1(25),2,4,6(27),22(26),23-hexaene-26,27-diol (PubChem CID 11060927) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 8,11,14,17,20-pentazatricyclo[20.3.1.12,6]heptacosa-1(25),2,4,6(27),22(26),23-hexaene-26,27-diol.
| Compound Name | 8,11,14,17,20-pentazatricyclo[20.3.1.12,6]heptacosa-1(25),2,4,6(27),22(26),23-hexaene-26,27-diol |
|---|---|
| PubChem CID | 11060927 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 8,11,14,17,20-pentazatricyclo[20.3.1.12,6]heptacosa-1(25),2,4,6(27),22(26),23-hexaene-26,27-diol |
| SMILES | Oc1c2cccc1-c1cccc(c1O)CNCCNCCNCCNCCNC2 |
| InChI | InChI=1S/C22H33N5O2/c28-21-17-3-1-5-19(21)20-6-2-4-18(22(20)29)16-27-14-12-25-10-8-23-7-9-24-11-13-26-15-17/h1-6,23-29H,7-16H2 |
| InChIKey | RWFQFDNYORBOJA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|