C32H36N2O12 — CID 11061250
trimethyl (2R,3R,4S,6R,7S,8S)-2-(2-methoxy-2-oxoethyl)-10-oxo-7-phenylmethoxy-6-(phenylmethoxymethyl)-5-oxa-1,11-diazatricyclo[6.3.0.04,11]undecane-2,3,4-tricarboxylate (PubChem CID 11061250) has the molecular formula C32H36N2O12 and a molecular weight of 640.64 g/mol. Its IUPAC name is trimethyl (2R,3R,4S,6R,7S,8S)-2-(2-methoxy-2-oxoethyl)-10-oxo-7-phenylmethoxy-6-(phenylmethoxymethyl)-5-oxa-1,11-diazatricyclo[6.3.0.04,11]undecane-2,3,4-tricarboxylate.
| Compound Name | trimethyl (2R,3R,4S,6R,7S,8S)-2-(2-methoxy-2-oxoethyl)-10-oxo-7-phenylmethoxy-6-(phenylmethoxymethyl)-5-oxa-1,11-diazatricyclo[6.3.0.04,11]undecane-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 11061250 |
| Molecular Formula | C32H36N2O12 |
| Molecular Weight | 640.64 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | trimethyl (2R,3R,4S,6R,7S,8S)-2-(2-methoxy-2-oxoethyl)-10-oxo-7-phenylmethoxy-6-(phenylmethoxymethyl)-5-oxa-1,11-diazatricyclo[6.3.0.04,11]undecane-2,3,4-tricarboxylate |
| SMILES | COC(=O)C[C@]1(C(=O)OC)[C@@H](C(=O)OC)[C@@]2(C(=O)OC)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]3CC(=O)N2N31 |
| InChI | InChI=1S/C32H36N2O12/c1-40-25(36)16-31(29(38)42-3)27(28(37)41-2)32(30(39)43-4)34-24(35)15-22(33(31)34)26(45-18-21-13-9-6-10-14-21)23(46-32)19-44-17-20-11-7-5-8-12-20/h5-14,22-23,26-27H,15-19H2,1-4H3/t22-,23+,26-,27+,31+,32-/m0/s1 |
| InChIKey | ZOEVVKLRUCMHPM-SQKZJAMSSA-N |
| XLogP | 1.15 |
| TPSA | 156.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.64 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|