C25H30N2O11 — CID 101155801
tetramethyl (4R,5R,6S,8S,9R,10R,11S)-6-methyl-2-oxo-5-phenylmethoxy-7-oxa-1,12-diazatricyclo[6.3.1.04,12]dodecane-8,9,10,11-tetracarboxylate (PubChem CID 101155801) has the molecular formula C25H30N2O11 and a molecular weight of 534.52 g/mol. Its IUPAC name is tetramethyl (4R,5R,6S,8S,9R,10R,11S)-6-methyl-2-oxo-5-phenylmethoxy-7-oxa-1,12-diazatricyclo[6.3.1.04,12]dodecane-8,9,10,11-tetracarboxylate.
| Compound Name | tetramethyl (4R,5R,6S,8S,9R,10R,11S)-6-methyl-2-oxo-5-phenylmethoxy-7-oxa-1,12-diazatricyclo[6.3.1.04,12]dodecane-8,9,10,11-tetracarboxylate |
|---|---|
| PubChem CID | 101155801 |
| Molecular Formula | C25H30N2O11 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | tetramethyl (4R,5R,6S,8S,9R,10R,11S)-6-methyl-2-oxo-5-phenylmethoxy-7-oxa-1,12-diazatricyclo[6.3.1.04,12]dodecane-8,9,10,11-tetracarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](C(=O)OC)N2C(=O)C[C@@H]3[C@@H](OCc4ccccc4)[C@H](C)O[C@](C(=O)OC)([C@@H]1C(=O)OC)N32 |
| InChI | InChI=1S/C25H30N2O11/c1-13-20(37-12-14-9-7-6-8-10-14)15-11-16(28)26-19(23(31)35-4)17(21(29)33-2)18(22(30)34-3)25(38-13,27(15)26)24(32)36-5/h6-10,13,15,17-20H,11-12H2,1-5H3/t13-,15+,17+,18-,19-,20-,25-/m0/s1 |
| InChIKey | ZHRWMHDWCSBQMC-ZEZFFESNSA-N |
| XLogP | -0.19 |
| TPSA | 147.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|