C17H19NO6 — CID 88508147
methyl 5-isocyanato-2,5-dimethyl-6-oxo-4-phenylmethoxyoxane-3-carboxylate (PubChem CID 88508147) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is methyl 5-isocyanato-2,5-dimethyl-6-oxo-4-phenylmethoxyoxane-3-carboxylate.
| Compound Name | methyl 5-isocyanato-2,5-dimethyl-6-oxo-4-phenylmethoxyoxane-3-carboxylate |
|---|---|
| PubChem CID | 88508147 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | methyl 5-isocyanato-2,5-dimethyl-6-oxo-4-phenylmethoxyoxane-3-carboxylate |
| SMILES | COC(=O)C1C(C)OC(=O)C(C)(N=C=O)C1OCc1ccccc1 |
| InChI | InChI=1S/C17H19NO6/c1-11-13(15(20)22-3)14(17(2,18-10-19)16(21)24-11)23-9-12-7-5-4-6-8-12/h4-8,11,13-14H,9H2,1-3H3 |
| InChIKey | YFTHZYNFIMEUPC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|