C18H14F3NO3 — CID 110647121
3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-7-yl-(2,3,4-trifluorophenyl)methanone (PubChem CID 110647121) has the molecular formula C18H14F3NO3 and a molecular weight of 349.31 g/mol. Its IUPAC name is 3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-7-yl-(2,3,4-trifluorophenyl)methanone.
| Compound Name | 3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-7-yl-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 110647121 |
| Molecular Formula | C18H14F3NO3 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-7-yl-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)N1CCc2cc3c(cc2C1)OCCO3 |
| InChI | InChI=1S/C18H14F3NO3/c19-13-2-1-12(16(20)17(13)21)18(23)22-4-3-10-7-14-15(8-11(10)9-22)25-6-5-24-14/h1-2,7-8H,3-6,9H2 |
| InChIKey | BRAAELKALLLLOQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|