C8H17ISi — CID 11065429
(3R,4R)-3-(iodomethyl)-1,1,4-trimethylsilolane (PubChem CID 11065429) has the molecular formula C8H17ISi and a molecular weight of 268.21 g/mol. Its IUPAC name is (3R,4R)-3-(iodomethyl)-1,1,4-trimethylsilolane.
| Compound Name | (3R,4R)-3-(iodomethyl)-1,1,4-trimethylsilolane |
|---|---|
| PubChem CID | 11065429 |
| Molecular Formula | C8H17ISi |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | (3R,4R)-3-(iodomethyl)-1,1,4-trimethylsilolane |
| SMILES | C[C@H]1C[Si](C)(C)C[C@@H]1CI |
| InChI | InChI=1S/C8H17ISi/c1-7-5-10(2,3)6-8(7)4-9/h7-8H,4-6H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | UFGCMMPLAXQFJW-YUMQZZPRSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|