C21H32O5SSi — CID 11069919
methyl 2-(benzenesulfonyl)-2-[3-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]acetate (PubChem CID 11069919) has the molecular formula C21H32O5SSi and a molecular weight of 424.64 g/mol. Its IUPAC name is methyl 2-(benzenesulfonyl)-2-[3-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]acetate.
| Compound Name | methyl 2-(benzenesulfonyl)-2-[3-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 11069919 |
| Molecular Formula | C21H32O5SSi |
| Molecular Weight | 424.64 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | methyl 2-(benzenesulfonyl)-2-[3-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]acetate |
| SMILES | COC(=O)C(C1C=C(O[Si](C)(C)C(C)(C)C)CCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H32O5SSi/c1-21(2,3)28(5,6)26-17-12-10-11-16(15-17)19(20(22)25-4)27(23,24)18-13-8-7-9-14-18/h7-9,13-16,19H,10-12H2,1-6H3 |
| InChIKey | RYPZAYGTHZKJFY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|