C13H9N3O3S — CID 110734493
N-(1,4-dioxo-2,3-dihydrophthalazin-6-yl)thiophene-2-carboxamide (PubChem CID 110734493) has the molecular formula C13H9N3O3S and a molecular weight of 287.30 g/mol. Its IUPAC name is N-(1,4-dioxo-2,3-dihydrophthalazin-6-yl)thiophene-2-carboxamide.
| Compound Name | N-(1,4-dioxo-2,3-dihydrophthalazin-6-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 110734493 |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | N-(1,4-dioxo-2,3-dihydrophthalazin-6-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(=O)[nH][nH]c(=O)c2c1)c1cccs1 |
| InChI | InChI=1S/C13H9N3O3S/c17-11-8-4-3-7(6-9(8)12(18)16-15-11)14-13(19)10-2-1-5-20-10/h1-6H,(H,14,19)(H,15,17)(H,16,18) |
| InChIKey | NXKRNPJBBPSWHR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |