C18H19N3O4 — CID 110743499
5-amino-3-[2-(3,4-dimethoxyphenyl)acetyl]-1-methylbenzimidazol-2-one (PubChem CID 110743499) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 5-amino-3-[2-(3,4-dimethoxyphenyl)acetyl]-1-methylbenzimidazol-2-one.
| Compound Name | 5-amino-3-[2-(3,4-dimethoxyphenyl)acetyl]-1-methylbenzimidazol-2-one |
|---|---|
| PubChem CID | 110743499 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 5-amino-3-[2-(3,4-dimethoxyphenyl)acetyl]-1-methylbenzimidazol-2-one |
| SMILES | COc1ccc(CC(=O)n2c(=O)n(C)c3ccc(N)cc32)cc1OC |
| InChI | InChI=1S/C18H19N3O4/c1-20-13-6-5-12(19)10-14(13)21(18(20)23)17(22)9-11-4-7-15(24-2)16(8-11)25-3/h4-8,10H,9,19H2,1-3H3 |
| InChIKey | BVUBQRLCHOHGAG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|