C18H18S — CID 11076390
(1R,5S)-3-(1H-inden-2-ylmethylidene)bicyclo[3.2.1]octane-8-thione (PubChem CID 11076390) has the molecular formula C18H18S and a molecular weight of 266.41 g/mol. Its IUPAC name is (1R,5S)-3-(1H-inden-2-ylmethylidene)bicyclo[3.2.1]octane-8-thione.
| Compound Name | (1R,5S)-3-(1H-inden-2-ylmethylidene)bicyclo[3.2.1]octane-8-thione |
|---|---|
| PubChem CID | 11076390 |
| Molecular Formula | C18H18S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (1R,5S)-3-(1H-inden-2-ylmethylidene)bicyclo[3.2.1]octane-8-thione |
| SMILES | S=C1[C@@H]2CC[C@H]1C/C(=C/C1=Cc3ccccc3C1)C2 |
| InChI | InChI=1S/C18H18S/c19-18-16-5-6-17(18)11-13(10-16)7-12-8-14-3-1-2-4-15(14)9-12/h1-4,7-8,16-17H,5-6,9-11H2/b13-7-/t16-,17+/m0/s1 |
| InChIKey | SBRHJKXTHNKHNR-QIDGOZRWSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|