C18H20O3 — CID 11076961
(2R,4aR,6Z,9Z,11aS)-6-ethenyl-2-phenyl-4a,8,11,11a-tetrahydro-4H-[1,3]dioxino[5,4-b]oxonine (PubChem CID 11076961) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is (2R,4aR,6Z,9Z,11aS)-6-ethenyl-2-phenyl-4a,8,11,11a-tetrahydro-4H-[1,3]dioxino[5,4-b]oxonine.
| Compound Name | (2R,4aR,6Z,9Z,11aS)-6-ethenyl-2-phenyl-4a,8,11,11a-tetrahydro-4H-[1,3]dioxino[5,4-b]oxonine |
|---|---|
| PubChem CID | 11076961 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (2R,4aR,6Z,9Z,11aS)-6-ethenyl-2-phenyl-4a,8,11,11a-tetrahydro-4H-[1,3]dioxino[5,4-b]oxonine |
| SMILES | C=C/C1=C/C/C=C\C[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C18H20O3/c1-2-15-11-7-4-8-12-16-17(20-15)13-19-18(21-16)14-9-5-3-6-10-14/h2-6,8-11,16-18H,1,7,12-13H2/b8-4-,15-11-/t16-,17+,18+/m0/s1 |
| InChIKey | DLXDWEBHEDUCGN-GJFDPNFRSA-N |
| XLogP | 3.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|