C26H50O4Sn — CID 11082137
butyl 2-[(4R,6R)-2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate (PubChem CID 11082137) has the molecular formula C26H50O4Sn and a molecular weight of 545.39 g/mol. Its IUPAC name is butyl 2-[(4R,6R)-2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate.
| Compound Name | butyl 2-[(4R,6R)-2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 11082137 |
| Molecular Formula | C26H50O4Sn |
| Molecular Weight | 545.39 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | butyl 2-[(4R,6R)-2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate |
| SMILES | CCCCOC(=O)C[C@H]1C[C@H](/C=C/[Sn](CCCC)(CCCC)CCCC)OC(C)(C)O1 |
| InChI | InChI=1S/C14H23O4.3C4H9.Sn/c1-5-7-8-16-13(15)10-12-9-11(6-2)17-14(3,4)18-12;3*1-3-4-2;/h2,6,11-12H,5,7-10H2,1,3-4H3;3*1,3-4H2,2H3;/t11-,12+;;;;/m0..../s1 |
| InChIKey | DSIOERHCMDFRNI-QHSFPFIWSA-N |
| XLogP | 7.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.39 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|