C31H56O6Si — CID 11082214
methyl (5Z,9S,10E)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-5,10-dienoate (PubChem CID 11082214) has the molecular formula C31H56O6Si and a molecular weight of 552.87 g/mol. Its IUPAC name is methyl (5Z,9S,10E)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-5,10-dienoate.
| Compound Name | methyl (5Z,9S,10E)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-5,10-dienoate |
|---|---|
| PubChem CID | 11082214 |
| Molecular Formula | C31H56O6Si |
| Molecular Weight | 552.87 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | methyl (5Z,9S,10E)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-5,10-dienoate |
| SMILES | CCCCCC(/C=C/[C@@H](C(C/C=C\CCCC(=O)OC)C(C)=O)[C@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H56O6Si/c1-11-12-15-18-25(37-38(9,10)30(3,4)5)21-22-27(28-23-35-31(6,7)36-28)26(24(2)32)19-16-13-14-17-20-29(33)34-8/h13,16,21-22,25-28H,11-12,14-15,17-20,23H2,1-10H3/b16-13-,22-21+/t25?,26?,27-,28+/m0/s1 |
| InChIKey | IJGKSSYVJOUZMZ-PSQYIZQESA-N |
| XLogP | 7.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.87 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|