C38H48N2O3S2Si — CID 11082924
O-[(3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-ethyl-1-[2-(1H-indol-3-yl)ethyl]-2-oxopiperidin-4-yl] methylsulfanylmethanethioate (PubChem CID 11082924) has the molecular formula C38H48N2O3S2Si and a molecular weight of 673.03 g/mol. Its IUPAC name is O-[(3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-ethyl-1-[2-(1H-indol-3-yl)ethyl]-2-oxopiperidin-4-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-ethyl-1-[2-(1H-indol-3-yl)ethyl]-2-oxopiperidin-4-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 11082924 |
| Molecular Formula | C38H48N2O3S2Si |
| Molecular Weight | 673.03 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | O-[(3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-ethyl-1-[2-(1H-indol-3-yl)ethyl]-2-oxopiperidin-4-yl] methylsulfanylmethanethioate |
| SMILES | CC[C@]1(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(=O)N(CCc2c[nH]c3ccccc23)CCC1OC(=S)SC |
| InChI | InChI=1S/C38H48N2O3S2Si/c1-6-38(24-15-27-42-46(37(2,3)4,30-16-9-7-10-17-30)31-18-11-8-12-19-31)34(43-36(44)45-5)23-26-40(35(38)41)25-22-29-28-39-33-21-14-13-20-32(29)33/h7-14,16-21,28,34,39H,6,15,22-27H2,1-5H3/t34?,38-/m1/s1 |
| InChIKey | IPARYMVFUZZJIZ-CTHLUNGHSA-N |
| XLogP | 7.73 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.03 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|