C63H60O8S — CID 11083587
methyl (2R,4S,5R,6R)-6-[(1R,2R)-1,2-bis(phenylmethoxy)-3-trityloxypropyl]-4,5-bis(phenylmethoxy)-2-phenylsulfanyloxane-2-carboxylate (PubChem CID 11083587) has the molecular formula C63H60O8S and a molecular weight of 977.23 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-6-[(1R,2R)-1,2-bis(phenylmethoxy)-3-trityloxypropyl]-4,5-bis(phenylmethoxy)-2-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-6-[(1R,2R)-1,2-bis(phenylmethoxy)-3-trityloxypropyl]-4,5-bis(phenylmethoxy)-2-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 11083587 |
| Molecular Formula | C63H60O8S |
| Molecular Weight | 977.23 g/mol |
| Exact Mass | 976.40 |
| IUPAC Name | methyl (2R,4S,5R,6R)-6-[(1R,2R)-1,2-bis(phenylmethoxy)-3-trityloxypropyl]-4,5-bis(phenylmethoxy)-2-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]([C@H](OCc2ccccc2)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)OCc2ccccc2)O1 |
| InChI | InChI=1S/C63H60O8S/c1-65-61(64)62(72-55-40-24-9-25-41-55)42-56(66-43-48-26-10-2-11-27-48)58(68-45-50-30-14-4-15-31-50)60(71-62)59(69-46-51-32-16-5-17-33-51)57(67-44-49-28-12-3-13-29-49)47-70-63(52-34-18-6-19-35-52,53-36-20-7-21-37-53)54-38-22-8-23-39-54/h2-41,56-60H,42-47H2,1H3/t56-,57+,58+,59+,60+,62+/m0/s1 |
| InChIKey | ITMJGDMEWMQMOY-RQAQEWPYSA-N |
| XLogP | 12.79 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.23 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|