C10H9ClO — CID 11095231
2-buta-1,3-dien-2-yl-4-chlorophenol (PubChem CID 11095231) has the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yl-4-chlorophenol.
| Compound Name | 2-buta-1,3-dien-2-yl-4-chlorophenol |
|---|---|
| PubChem CID | 11095231 |
| Molecular Formula | C10H9ClO |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 2-buta-1,3-dien-2-yl-4-chlorophenol |
| SMILES | C=CC(=C)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C10H9ClO/c1-3-7(2)9-6-8(11)4-5-10(9)12/h3-6,12H,1-2H2 |
| InChIKey | QMORMGJNESQOSM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|