C11H8Cl4N2O — CID 89199587
N'-[(1E)-2,3-dichloro-1-(5-chloro-2-hydroxyphenyl)buta-1,3-dienyl]carbamimidoyl chloride (PubChem CID 89199587) has the molecular formula C11H8Cl4N2O and a molecular weight of 326.01 g/mol. Its IUPAC name is N'-[(1E)-2,3-dichloro-1-(5-chloro-2-hydroxyphenyl)buta-1,3-dienyl]carbamimidoyl chloride.
| Compound Name | N'-[(1E)-2,3-dichloro-1-(5-chloro-2-hydroxyphenyl)buta-1,3-dienyl]carbamimidoyl chloride |
|---|---|
| PubChem CID | 89199587 |
| Molecular Formula | C11H8Cl4N2O |
| Molecular Weight | 326.01 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | N'-[(1E)-2,3-dichloro-1-(5-chloro-2-hydroxyphenyl)buta-1,3-dienyl]carbamimidoyl chloride |
| SMILES | C=C(Cl)/C(Cl)=C(\N=C(\N)Cl)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C11H8Cl4N2O/c1-5(12)9(14)10(17-11(15)16)7-4-6(13)2-3-8(7)18/h2-4,18H,1H2,(H2,16,17)/b10-9+ |
| InChIKey | NCVVOFNWBXNBCI-MDZDMXLPSA-N |
| XLogP | 4.26 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.01 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|