C10H8Cl2 — CID 123840660
2-buta-1,3-dien-2-yl-1,4-dichlorobenzene (PubChem CID 123840660) has the molecular formula C10H8Cl2 and a molecular weight of 199.08 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yl-1,4-dichlorobenzene.
| Compound Name | 2-buta-1,3-dien-2-yl-1,4-dichlorobenzene |
|---|---|
| PubChem CID | 123840660 |
| Molecular Formula | C10H8Cl2 |
| Molecular Weight | 199.08 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 2-buta-1,3-dien-2-yl-1,4-dichlorobenzene |
| SMILES | C=CC(=C)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H8Cl2/c1-3-7(2)9-6-8(11)4-5-10(9)12/h3-6H,1-2H2 |
| InChIKey | BFIOQUJPFRBBRH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.08 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|