C25H31Cl2NS — CID 143451230
ethane;prop-2-enyl 4-[1-(2,5-dichlorophenyl)ethenyl]-N-prop-2-enylbenzenecarboximidothioate (PubChem CID 143451230) has the molecular formula C25H31Cl2NS and a molecular weight of 448.50 g/mol. Its IUPAC name is ethane;prop-2-enyl 4-[1-(2,5-dichlorophenyl)ethenyl]-N-prop-2-enylbenzenecarboximidothioate.
| Compound Name | ethane;prop-2-enyl 4-[1-(2,5-dichlorophenyl)ethenyl]-N-prop-2-enylbenzenecarboximidothioate |
|---|---|
| PubChem CID | 143451230 |
| Molecular Formula | C25H31Cl2NS |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | ethane;prop-2-enyl 4-[1-(2,5-dichlorophenyl)ethenyl]-N-prop-2-enylbenzenecarboximidothioate |
| SMILES | C=CC/N=C(\SCC=C)c1ccc(C(=C)c2cc(Cl)ccc2Cl)cc1.CC.CC |
| InChI | InChI=1S/C21H19Cl2NS.2C2H6/c1-4-12-24-21(25-13-5-2)17-8-6-16(7-9-17)15(3)19-14-18(22)10-11-20(19)23;2*1-2/h4-11,14H,1-3,12-13H2;2*1-2H3/b24-21-;; |
| InChIKey | PDYBEHJFXHNNFN-FTPDKCCJSA-N |
| XLogP | 8.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|