About 1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene
1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene (PubChem CID 66551631) has the molecular formula C8H4Cl4
and a molecular weight of 241.93 g/mol. Its IUPAC name is 1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene.
Analyze 1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene?
The IUPAC name of 1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene (CID 66551631) is 1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene.
What is the SMILES notation for 1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene?
The canonical SMILES for 1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene is Cl/C=C(\Cl)c1cc(Cl)ccc1Cl.
What is the InChIKey of 1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene?
The InChIKey is ORVBQFBEPQDPOO-YWEYNIOJSA-N. The full InChI is InChI=1S/C8H4Cl4/c9-4-8(12)6-3-5(10)1-2-7(6)11/h1-4H/b8-4-.
What are the key properties of 1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene?
1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene has a molecular weight of 241.93 g/mol, XLogP of 4.77, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dichloro-2-[(Z)-1,2-dichloroethenyl]benzene is sourced from PubChem (CID 66551631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).