C8H5Cl3OS — CID 54413380
2-chloro-1-(2,5-dichlorophenyl)-2-hydroxyethanethione (PubChem CID 54413380) has the molecular formula C8H5Cl3OS and a molecular weight of 255.55 g/mol. Its IUPAC name is 2-chloro-1-(2,5-dichlorophenyl)-2-hydroxyethanethione.
| Compound Name | 2-chloro-1-(2,5-dichlorophenyl)-2-hydroxyethanethione |
|---|---|
| PubChem CID | 54413380 |
| Molecular Formula | C8H5Cl3OS |
| Molecular Weight | 255.55 g/mol |
| Exact Mass | 253.91 |
| IUPAC Name | 2-chloro-1-(2,5-dichlorophenyl)-2-hydroxyethanethione |
| SMILES | OC(Cl)C(=S)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H5Cl3OS/c9-4-1-2-6(10)5(3-4)7(13)8(11)12/h1-3,8,12H |
| InChIKey | VVRZIKGJZXENPE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|