C18H15F3OS — CID 11099757
[(E)-3,3,3-trifluoro-2-[(E)-3-phenylprop-2-enoxy]prop-1-enyl]sulfanylbenzene (PubChem CID 11099757) has the molecular formula C18H15F3OS and a molecular weight of 336.38 g/mol. Its IUPAC name is [(E)-3,3,3-trifluoro-2-[(E)-3-phenylprop-2-enoxy]prop-1-enyl]sulfanylbenzene.
| Compound Name | [(E)-3,3,3-trifluoro-2-[(E)-3-phenylprop-2-enoxy]prop-1-enyl]sulfanylbenzene |
|---|---|
| PubChem CID | 11099757 |
| Molecular Formula | C18H15F3OS |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [(E)-3,3,3-trifluoro-2-[(E)-3-phenylprop-2-enoxy]prop-1-enyl]sulfanylbenzene |
| SMILES | FC(F)(F)/C(=C\Sc1ccccc1)OC/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H15F3OS/c19-18(20,21)17(14-23-16-11-5-2-6-12-16)22-13-7-10-15-8-3-1-4-9-15/h1-12,14H,13H2/b10-7+,17-14+ |
| InChIKey | VPZVGMGSMAVTPV-GKOPTJFUSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|