C22H31NO3 — CID 11100418
1-[(7R)-7-methyl-8-[(1R)-1-phenylethyl]imino-1,4-dioxaspiro[4.5]decan-7-yl]pentan-3-one (PubChem CID 11100418) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 1-[(7R)-7-methyl-8-[(1R)-1-phenylethyl]imino-1,4-dioxaspiro[4.5]decan-7-yl]pentan-3-one.
| Compound Name | 1-[(7R)-7-methyl-8-[(1R)-1-phenylethyl]imino-1,4-dioxaspiro[4.5]decan-7-yl]pentan-3-one |
|---|---|
| PubChem CID | 11100418 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1-[(7R)-7-methyl-8-[(1R)-1-phenylethyl]imino-1,4-dioxaspiro[4.5]decan-7-yl]pentan-3-one |
| SMILES | CCC(=O)CC[C@]1(C)CC2(CC/C1=N\[C@H](C)c1ccccc1)OCCO2 |
| InChI | InChI=1S/C22H31NO3/c1-4-19(24)10-12-21(3)16-22(25-14-15-26-22)13-11-20(21)23-17(2)18-8-6-5-7-9-18/h5-9,17H,4,10-16H2,1-3H3/b23-20+/t17-,21-/m1/s1 |
| InChIKey | LJFKURODAFRCDY-YNXNDPGNSA-N |
| XLogP | 4.88 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|