C20H27NO4 — CID 142977427
ethyl (7R)-8-[[(1R)-1-phenylethyl]iminomethyl]-1,4-dioxaspiro[4.5]decane-7-carboxylate (PubChem CID 142977427) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl (7R)-8-[[(1R)-1-phenylethyl]iminomethyl]-1,4-dioxaspiro[4.5]decane-7-carboxylate.
| Compound Name | ethyl (7R)-8-[[(1R)-1-phenylethyl]iminomethyl]-1,4-dioxaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 142977427 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | ethyl (7R)-8-[[(1R)-1-phenylethyl]iminomethyl]-1,4-dioxaspiro[4.5]decane-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC2(CCC1/C=N/[C@H](C)c1ccccc1)OCCO2 |
| InChI | InChI=1S/C20H27NO4/c1-3-23-19(22)18-13-20(24-11-12-25-20)10-9-17(18)14-21-15(2)16-7-5-4-6-8-16/h4-8,14-15,17-18H,3,9-13H2,1-2H3/b21-14+/t15-,17?,18-/m1/s1 |
| InChIKey | XSRMGDDNCQZNCV-JBQKDINBSA-N |
| XLogP | 3.54 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|