C18H30O3 — CID 11109179
1-ethoxy-2-[1-(methoxymethoxy)-3-methylbut-2-enyl]-4,4-dimethyl-3-methylidenecyclohexene (PubChem CID 11109179) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-ethoxy-2-[1-(methoxymethoxy)-3-methylbut-2-enyl]-4,4-dimethyl-3-methylidenecyclohexene.
| Compound Name | 1-ethoxy-2-[1-(methoxymethoxy)-3-methylbut-2-enyl]-4,4-dimethyl-3-methylidenecyclohexene |
|---|---|
| PubChem CID | 11109179 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 1-ethoxy-2-[1-(methoxymethoxy)-3-methylbut-2-enyl]-4,4-dimethyl-3-methylidenecyclohexene |
| SMILES | C=C1C(C(C=C(C)C)OCOC)=C(OCC)CCC1(C)C |
| InChI | InChI=1S/C18H30O3/c1-8-20-15-9-10-18(5,6)14(4)17(15)16(11-13(2)3)21-12-19-7/h11,16H,4,8-10,12H2,1-3,5-7H3 |
| InChIKey | LKQIRUJWPFDQQO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|