C26H44O3 — CID 134875407
1,3,3-trimethyl-2-[(1E,3E,7E)-5,9,9-triethoxy-3,7-dimethylnona-1,3,7-trienyl]cyclohexene (PubChem CID 134875407) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,7E)-5,9,9-triethoxy-3,7-dimethylnona-1,3,7-trienyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,7E)-5,9,9-triethoxy-3,7-dimethylnona-1,3,7-trienyl]cyclohexene |
|---|---|
| PubChem CID | 134875407 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,7E)-5,9,9-triethoxy-3,7-dimethylnona-1,3,7-trienyl]cyclohexene |
| SMILES | CCOC(/C=C(C)/C=C/C1=C(C)CCCC1(C)C)C/C(C)=C/C(OCC)OCC |
| InChI | InChI=1S/C26H44O3/c1-9-27-23(18-21(5)19-25(28-10-2)29-11-3)17-20(4)14-15-24-22(6)13-12-16-26(24,7)8/h14-15,17,19,23,25H,9-13,16,18H2,1-8H3/b15-14+,20-17+,21-19+ |
| InChIKey | IIVMPMHBZUYMKA-WCVLBPRBSA-N |
| XLogP | 7.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|