C26H44O3 — CID 134937922
2-[(1E,3E)-6-(diethoxymethyl)-5-ethoxy-3,7-dimethylocta-1,3,7-trienyl]-1,3,3-trimethylcyclohexene (PubChem CID 134937922) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is 2-[(1E,3E)-6-(diethoxymethyl)-5-ethoxy-3,7-dimethylocta-1,3,7-trienyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E)-6-(diethoxymethyl)-5-ethoxy-3,7-dimethylocta-1,3,7-trienyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 134937922 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | 2-[(1E,3E)-6-(diethoxymethyl)-5-ethoxy-3,7-dimethylocta-1,3,7-trienyl]-1,3,3-trimethylcyclohexene |
| SMILES | C=C(C)C(C(/C=C(C)/C=C/C1=C(C)CCCC1(C)C)OCC)C(OCC)OCC |
| InChI | InChI=1S/C26H44O3/c1-10-27-23(24(19(4)5)25(28-11-2)29-12-3)18-20(6)15-16-22-21(7)14-13-17-26(22,8)9/h15-16,18,23-25H,4,10-14,17H2,1-3,5-9H3/b16-15+,20-18+ |
| InChIKey | OEOWKXGUQCMGFB-OCEQPANSSA-N |
| XLogP | 7.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|