C16H28O2 — CID 10106264
2-[(E)-3,3-diethoxyprop-1-enyl]-1,3,3-trimethylcyclohexene (PubChem CID 10106264) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-[(E)-3,3-diethoxyprop-1-enyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(E)-3,3-diethoxyprop-1-enyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 10106264 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2-[(E)-3,3-diethoxyprop-1-enyl]-1,3,3-trimethylcyclohexene |
| SMILES | CCOC(/C=C/C1=C(C)CCCC1(C)C)OCC |
| InChI | InChI=1S/C16H28O2/c1-6-17-15(18-7-2)11-10-14-13(3)9-8-12-16(14,4)5/h10-11,15H,6-9,12H2,1-5H3/b11-10+ |
| InChIKey | KUUPNGZCUPNWTH-ZHACJKMWSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|