C25H44O3 — CID 134990357
1,3,3-trimethyl-2-[(2E,4E)-6,8,8-triethoxy-3,7-dimethylocta-2,4-dienyl]cyclohexene (PubChem CID 134990357) has the molecular formula C25H44O3 and a molecular weight of 392.62 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(2E,4E)-6,8,8-triethoxy-3,7-dimethylocta-2,4-dienyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(2E,4E)-6,8,8-triethoxy-3,7-dimethylocta-2,4-dienyl]cyclohexene |
|---|---|
| PubChem CID | 134990357 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | 1,3,3-trimethyl-2-[(2E,4E)-6,8,8-triethoxy-3,7-dimethylocta-2,4-dienyl]cyclohexene |
| SMILES | CCOC(/C=C/C(C)=C/CC1=C(C)CCCC1(C)C)C(C)C(OCC)OCC |
| InChI | InChI=1S/C25H44O3/c1-9-26-23(21(6)24(27-10-2)28-11-3)17-15-19(4)14-16-22-20(5)13-12-18-25(22,7)8/h14-15,17,21,23-24H,9-13,16,18H2,1-8H3/b17-15+,19-14+ |
| InChIKey | MTFQWEIYXKMIAF-UHOLLTQSSA-N |
| XLogP | 6.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|