C14H25F3N4O2S — CID 111118207
4-methyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]piperidine-1-carboximidamide (PubChem CID 111118207) has the molecular formula C14H25F3N4O2S and a molecular weight of 370.44 g/mol. Its IUPAC name is 4-methyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]piperidine-1-carboximidamide.
| Compound Name | 4-methyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111118207 |
| Molecular Formula | C14H25F3N4O2S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-methyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]piperidine-1-carboximidamide |
| SMILES | CC1CCN(/C(N)=N/CC2CCN(S(=O)(=O)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C14H25F3N4O2S/c1-11-2-6-20(7-3-11)13(18)19-10-12-4-8-21(9-5-12)24(22,23)14(15,16)17/h11-12H,2-10H2,1H3,(H2,18,19) |
| InChIKey | GFJGVFRMMXGWIW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|