C25H36O4Si — CID 11122835
ethyl (2R,3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,4-dimethylpentanoate (PubChem CID 11122835) has the molecular formula C25H36O4Si and a molecular weight of 428.65 g/mol. Its IUPAC name is ethyl (2R,3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,4-dimethylpentanoate.
| Compound Name | ethyl (2R,3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 11122835 |
| Molecular Formula | C25H36O4Si |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | ethyl (2R,3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,4-dimethylpentanoate |
| SMILES | CCOC(=O)[C@H](C)[C@H](O)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36O4Si/c1-7-28-24(27)20(3)23(26)19(2)18-29-30(25(4,5)6,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17,19-20,23,26H,7,18H2,1-6H3/t19-,20+,23+/m0/s1 |
| InChIKey | LRKMMSQTPBOLDX-MIZPHKNDSA-N |
| XLogP | 3.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|