C26H36O5Si — CID 11984446
tert-butyl (5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3-oxohexanoate (PubChem CID 11984446) has the molecular formula C26H36O5Si and a molecular weight of 456.66 g/mol. Its IUPAC name is tert-butyl (5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3-oxohexanoate.
| Compound Name | tert-butyl (5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3-oxohexanoate |
|---|---|
| PubChem CID | 11984446 |
| Molecular Formula | C26H36O5Si |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | tert-butyl (5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3-oxohexanoate |
| SMILES | CC(C)(C)OC(=O)CC(=O)C[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H36O5Si/c1-25(2,3)31-24(29)18-20(27)17-21(28)19-30-32(26(4,5)6,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,21,28H,17-19H2,1-6H3/t21-/m0/s1 |
| InChIKey | JNUVGMFPDXXYFF-NRFANRHFSA-N |
| XLogP | 3.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|