C25H34O5Si — CID 71489705
2-[(2R,4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-hydroxyoxan-2-yl]acetic acid (PubChem CID 71489705) has the molecular formula C25H34O5Si and a molecular weight of 442.63 g/mol. Its IUPAC name is 2-[(2R,4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-hydroxyoxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-hydroxyoxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 71489705 |
| Molecular Formula | C25H34O5Si |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 2-[(2R,4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-hydroxyoxan-2-yl]acetic acid |
| SMILES | CC(C)(C)[Si](OCC[C@H]1C[C@H](O)C[C@H](CC(=O)O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H34O5Si/c1-25(2,3)31(22-10-6-4-7-11-22,23-12-8-5-9-13-23)29-15-14-20-16-19(26)17-21(30-20)18-24(27)28/h4-13,19-21,26H,14-18H2,1-3H3,(H,27,28)/t19-,20-,21+/m0/s1 |
| InChIKey | KMPNXCFEHPAHRK-PCCBWWKXSA-N |
| XLogP | 3.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|