C26H34O4Si — CID 11517779
(4S,5R,6R)-6-[(Z)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylprop-1-enyl]-4-hydroxy-5-methyloxan-2-one (PubChem CID 11517779) has the molecular formula C26H34O4Si and a molecular weight of 438.64 g/mol. Its IUPAC name is (4S,5R,6R)-6-[(Z)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylprop-1-enyl]-4-hydroxy-5-methyloxan-2-one.
| Compound Name | (4S,5R,6R)-6-[(Z)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylprop-1-enyl]-4-hydroxy-5-methyloxan-2-one |
|---|---|
| PubChem CID | 11517779 |
| Molecular Formula | C26H34O4Si |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (4S,5R,6R)-6-[(Z)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylprop-1-enyl]-4-hydroxy-5-methyloxan-2-one |
| SMILES | C/C(=C/[C@H]1OC(=O)C[C@H](O)[C@H]1C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H34O4Si/c1-19(16-24-20(2)23(27)17-25(28)30-24)18-29-31(26(3,4)5,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-16,20,23-24,27H,17-18H2,1-5H3/b19-16-/t20-,23+,24-/m1/s1 |
| InChIKey | SNJYXPJOOQRJGR-MWCFODBRSA-N |
| XLogP | 3.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|