C20H30F3N5 — CID 111233973
N-[(1-ethylpyrrolidin-3-yl)methyl]-N'-methyl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide (PubChem CID 111233973) has the molecular formula C20H30F3N5 and a molecular weight of 397.49 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-3-yl)methyl]-N'-methyl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide.
| Compound Name | N-[(1-ethylpyrrolidin-3-yl)methyl]-N'-methyl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111233973 |
| Molecular Formula | C20H30F3N5 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-[(1-ethylpyrrolidin-3-yl)methyl]-N'-methyl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide |
| SMILES | CCN1CCC(CN/C(=N\C)N2CCN(c3cccc(C(F)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C20H30F3N5/c1-3-26-8-7-16(15-26)14-25-19(24-2)28-11-9-27(10-12-28)18-6-4-5-17(13-18)20(21,22)23/h4-6,13,16H,3,7-12,14-15H2,1-2H3,(H,24,25) |
| InChIKey | RRYNEHNSNRCLMD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|