C21H37N5O3S — CID 111284839
tert-butyl N-[2-[[N-ethyl-N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]-N-methylcarbamate (PubChem CID 111284839) has the molecular formula C21H37N5O3S and a molecular weight of 439.63 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 111284839 |
| Molecular Formula | C21H37N5O3S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]-N-methylcarbamate |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37N5O3S/c1-6-22-19(23-9-10-25(5)20(27)29-21(2,3)4)24-16-17(18-8-7-15-30-18)26-11-13-28-14-12-26/h7-8,15,17H,6,9-14,16H2,1-5H3,(H2,22,23,24) |
| InChIKey | MBAAWYDNSJERRA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|