C19H29N5O2 — CID 111296341
1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[3-(4-methylpyrazol-1-yl)propyl]guanidine (PubChem CID 111296341) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[3-(4-methylpyrazol-1-yl)propyl]guanidine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[3-(4-methylpyrazol-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111296341 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3-[3-(4-methylpyrazol-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCn1cc(C)cn1)N(C)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H29N5O2/c1-15-12-22-24(13-15)10-6-9-21-19(20-2)23(3)14-16-7-8-17(25-4)11-18(16)26-5/h7-8,11-13H,6,9-10,14H2,1-5H3,(H,20,21) |
| InChIKey | ONPYDJXPTAVKRC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|