C23H31N5OS — CID 111299151
N-[3-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 111299151) has the molecular formula C23H31N5OS and a molecular weight of 425.60 g/mol. Its IUPAC name is N-[3-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111299151 |
| Molecular Formula | C23H31N5OS |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | N-[3-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)N2CCCC2)c1)N(C)Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C23H31N5OS/c1-24-22(27(2)17-18-9-11-21(30-3)12-10-18)25-16-19-7-6-8-20(15-19)26-23(29)28-13-4-5-14-28/h6-12,15H,4-5,13-14,16-17H2,1-3H3,(H,24,25)(H,26,29) |
| InChIKey | PDZVSYCUXORUQR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|