C20H35N5O3S — CID 111301851
N'-methyl-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111301851) has the molecular formula C20H35N5O3S and a molecular weight of 425.60 g/mol. Its IUPAC name is N'-methyl-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111301851 |
| Molecular Formula | C20H35N5O3S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N'-methyl-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1(N2CCOCC2)CCSC1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C20H35N5O3S/c1-21-19(22-15-20(4-14-29-16-20)25-9-12-27-13-10-25)24-7-5-23(6-8-24)18(26)17-3-2-11-28-17/h17H,2-16H2,1H3,(H,21,22) |
| InChIKey | WGXGDBWPSVEXLV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|