C21H32N4OS — CID 111723939
N'-methyl-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-phenylpyrrolidine-1-carboximidamide (PubChem CID 111723939) has the molecular formula C21H32N4OS and a molecular weight of 388.58 g/mol. Its IUPAC name is N'-methyl-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-phenylpyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111723939 |
| Molecular Formula | C21H32N4OS |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N'-methyl-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-phenylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC1(N2CCOCC2)CCSC1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C21H32N4OS/c1-22-20(24-9-7-19(15-24)18-5-3-2-4-6-18)23-16-21(8-14-27-17-21)25-10-12-26-13-11-25/h2-6,19H,7-17H2,1H3,(H,22,23) |
| InChIKey | HADLMEINFLWOIB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|