C15H27N5O2S2 — CID 111367345
N-ethyl-N'-[2-(methanesulfonamido)ethyl]-4-(thiophen-2-ylmethyl)piperazine-1-carboximidamide (PubChem CID 111367345) has the molecular formula C15H27N5O2S2 and a molecular weight of 373.55 g/mol. Its IUPAC name is N-ethyl-N'-[2-(methanesulfonamido)ethyl]-4-(thiophen-2-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(methanesulfonamido)ethyl]-4-(thiophen-2-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111367345 |
| Molecular Formula | C15H27N5O2S2 |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-ethyl-N'-[2-(methanesulfonamido)ethyl]-4-(thiophen-2-ylmethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCNS(C)(=O)=O)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C15H27N5O2S2/c1-3-16-15(17-6-7-18-24(2,21)22)20-10-8-19(9-11-20)13-14-5-4-12-23-14/h4-5,12,18H,3,6-11,13H2,1-2H3,(H,16,17) |
| InChIKey | MCNNKNAECXEGIF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|