C21H31N5O2S — CID 111373837
N-ethyl-N'-[2-(methanesulfonamido)ethyl]-4-(naphthalen-1-ylmethyl)piperazine-1-carboximidamide (PubChem CID 111373837) has the molecular formula C21H31N5O2S and a molecular weight of 417.58 g/mol. Its IUPAC name is N-ethyl-N'-[2-(methanesulfonamido)ethyl]-4-(naphthalen-1-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(methanesulfonamido)ethyl]-4-(naphthalen-1-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111373837 |
| Molecular Formula | C21H31N5O2S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-ethyl-N'-[2-(methanesulfonamido)ethyl]-4-(naphthalen-1-ylmethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCNS(C)(=O)=O)N1CCN(Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C21H31N5O2S/c1-3-22-21(23-11-12-24-29(2,27)28)26-15-13-25(14-16-26)17-19-9-6-8-18-7-4-5-10-20(18)19/h4-10,24H,3,11-17H2,1-2H3,(H,22,23) |
| InChIKey | XUWYOXYBFSSDBM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|