C20H30ClIN6S — CID 111372044
1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111372044) has the molecular formula C20H30ClIN6S and a molecular weight of 548.93 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111372044 |
| Molecular Formula | C20H30ClIN6S |
| Molecular Weight | 548.93 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1nnc2n1CCCCC2)NCCSc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C20H29ClN6S.HI/c1-2-22-20(24-13-15-28-17-9-7-16(21)8-10-17)23-12-11-19-26-25-18-6-4-3-5-14-27(18)19;/h7-10H,2-6,11-15H2,1H3,(H2,22,23,24);1H |
| InChIKey | MFGKPDHKCWDVHP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.93 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|