C12H22INO — CID 11141836
(5,5-dimethyl-3-propoxycyclohex-2-en-1-ylidene)-methylazanium iodide (PubChem CID 11141836) has the molecular formula C12H22INO and a molecular weight of 323.22 g/mol. Its IUPAC name is (5,5-dimethyl-3-propoxycyclohex-2-en-1-ylidene)-methylazanium iodide.
| Compound Name | (5,5-dimethyl-3-propoxycyclohex-2-en-1-ylidene)-methylazanium iodide |
|---|---|
| PubChem CID | 11141836 |
| Molecular Formula | C12H22INO |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | (5,5-dimethyl-3-propoxycyclohex-2-en-1-ylidene)-methylazanium iodide |
| SMILES | CCCOC1=C/C(=[NH+]\C)CC(C)(C)C1.[I-] |
| InChI | InChI=1S/C12H21NO.HI/c1-5-6-14-11-7-10(13-4)8-12(2,3)9-11;/h7H,5-6,8-9H2,1-4H3;1H/b13-10+; |
| InChIKey | MQRFUUYTVGZBKC-RSGUCCNWSA-N |
| XLogP | -1.73 |
| TPSA | 23.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|